C27H26F3N5O5 — CID 6724603
N-[(2S)-3-hydroxy-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-2-[3-(trifluoromethyl)anilino]benzamide (PubChem CID 6724603) has the molecular formula C27H26F3N5O5 and a molecular weight of 557.53 g/mol. Its IUPAC name is N-[(2S)-3-hydroxy-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-2-[3-(trifluoromethyl)anilino]benzamide.
| Compound Name | N-[(2S)-3-hydroxy-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-2-[3-(trifluoromethyl)anilino]benzamide |
|---|---|
| PubChem CID | 6724603 |
| Molecular Formula | C27H26F3N5O5 |
| Molecular Weight | 557.53 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | N-[(2S)-3-hydroxy-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-2-[3-(trifluoromethyl)anilino]benzamide |
| SMILES | O=C(N[C@@H](CO)C(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1)c1ccccc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H26F3N5O5/c28-27(29,30)18-4-3-5-19(16-18)31-23-7-2-1-6-22(23)25(37)32-24(17-36)26(38)34-14-12-33(13-15-34)20-8-10-21(11-9-20)35(39)40/h1-11,16,24,31,36H,12-15,17H2,(H,32,37)/t24-/m0/s1 |
| InChIKey | WMXMYPOJAMDGNX-DEOSSOPVSA-N |
| XLogP | 3.80 |
| TPSA | 128.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|