C23H20F3N5O3 — CID 26199826
[4-(4-nitrophenyl)piperazin-1-yl]-[2-[3-(trifluoromethyl)anilino]-3-pyridinyl]methanone (PubChem CID 26199826) has the molecular formula C23H20F3N5O3 and a molecular weight of 471.44 g/mol. Its IUPAC name is [4-(4-nitrophenyl)piperazin-1-yl]-[2-[3-(trifluoromethyl)anilino]-3-pyridinyl]methanone.
| Compound Name | [4-(4-nitrophenyl)piperazin-1-yl]-[2-[3-(trifluoromethyl)anilino]-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 26199826 |
| Molecular Formula | C23H20F3N5O3 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | [4-(4-nitrophenyl)piperazin-1-yl]-[2-[3-(trifluoromethyl)anilino]-3-pyridinyl]methanone |
| SMILES | O=C(c1cccnc1Nc1cccc(C(F)(F)F)c1)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C23H20F3N5O3/c24-23(25,26)16-3-1-4-17(15-16)28-21-20(5-2-10-27-21)22(32)30-13-11-29(12-14-30)18-6-8-19(9-7-18)31(33)34/h1-10,15H,11-14H2,(H,27,28) |
| InChIKey | KENHLMGJUFQNNA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|