C22H20F2N4O — CID 166362766
[2-(3-fluoroanilino)-3-pyridinyl]-[4-(3-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 166362766) has the molecular formula C22H20F2N4O and a molecular weight of 394.43 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-3-pyridinyl]-[4-(3-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | [2-(3-fluoroanilino)-3-pyridinyl]-[4-(3-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 166362766 |
| Molecular Formula | C22H20F2N4O |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | [2-(3-fluoroanilino)-3-pyridinyl]-[4-(3-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cccnc1Nc1cccc(F)c1)N1CCN(c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C22H20F2N4O/c23-16-4-1-6-18(14-16)26-21-20(8-3-9-25-21)22(29)28-12-10-27(11-13-28)19-7-2-5-17(24)15-19/h1-9,14-15H,10-13H2,(H,25,26) |
| InChIKey | UZXGZNUEBOKWIT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |