C18H17F4N3O — CID 97077466
[2-(3-fluoroanilino)-3-pyridinyl]-[(3R)-3-(trifluoromethyl)piperidin-1-yl]methanone (PubChem CID 97077466) has the molecular formula C18H17F4N3O and a molecular weight of 367.35 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-3-pyridinyl]-[(3R)-3-(trifluoromethyl)piperidin-1-yl]methanone.
| Compound Name | [2-(3-fluoroanilino)-3-pyridinyl]-[(3R)-3-(trifluoromethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 97077466 |
| Molecular Formula | C18H17F4N3O |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | [2-(3-fluoroanilino)-3-pyridinyl]-[(3R)-3-(trifluoromethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cccnc1Nc1cccc(F)c1)N1CCC[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C18H17F4N3O/c19-13-5-1-6-14(10-13)24-16-15(7-2-8-23-16)17(26)25-9-3-4-12(11-25)18(20,21)22/h1-2,5-8,10,12H,3-4,9,11H2,(H,23,24)/t12-/m1/s1 |
| InChIKey | AFABITFFUBEHSY-GFCCVEGCSA-N |
| XLogP | 4.38 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |