C21H23F3N4O3 — CID 55844206
ethyl N-[1-[2-[3-(trifluoromethyl)anilino]pyridine-3-carbonyl]piperidin-3-yl]carbamate (PubChem CID 55844206) has the molecular formula C21H23F3N4O3 and a molecular weight of 436.43 g/mol. Its IUPAC name is ethyl N-[1-[2-[3-(trifluoromethyl)anilino]pyridine-3-carbonyl]piperidin-3-yl]carbamate.
| Compound Name | ethyl N-[1-[2-[3-(trifluoromethyl)anilino]pyridine-3-carbonyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 55844206 |
| Molecular Formula | C21H23F3N4O3 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | ethyl N-[1-[2-[3-(trifluoromethyl)anilino]pyridine-3-carbonyl]piperidin-3-yl]carbamate |
| SMILES | CCOC(=O)NC1CCCN(C(=O)c2cccnc2Nc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C21H23F3N4O3/c1-2-31-20(30)27-16-8-5-11-28(13-16)19(29)17-9-4-10-25-18(17)26-15-7-3-6-14(12-15)21(22,23)24/h3-4,6-7,9-10,12,16H,2,5,8,11,13H2,1H3,(H,25,26)(H,27,30) |
| InChIKey | WGOWCZXPIZJUEZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |