C20H22F3N3O2 — CID 55976721
(4-ethoxypiperidin-1-yl)-[2-[3-(trifluoromethyl)anilino]-3-pyridinyl]methanone (PubChem CID 55976721) has the molecular formula C20H22F3N3O2 and a molecular weight of 393.41 g/mol. Its IUPAC name is (4-ethoxypiperidin-1-yl)-[2-[3-(trifluoromethyl)anilino]-3-pyridinyl]methanone.
| Compound Name | (4-ethoxypiperidin-1-yl)-[2-[3-(trifluoromethyl)anilino]-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 55976721 |
| Molecular Formula | C20H22F3N3O2 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (4-ethoxypiperidin-1-yl)-[2-[3-(trifluoromethyl)anilino]-3-pyridinyl]methanone |
| SMILES | CCOC1CCN(C(=O)c2cccnc2Nc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H22F3N3O2/c1-2-28-16-8-11-26(12-9-16)19(27)17-7-4-10-24-18(17)25-15-6-3-5-14(13-15)20(21,22)23/h3-7,10,13,16H,2,8-9,11-12H2,1H3,(H,24,25) |
| InChIKey | WAZOUPAKYXVETE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |