C20H21N7O5 — CID 6723730
N-[(2S)-3-hydroxy-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-2H-benzotriazole-5-carboxamide (PubChem CID 6723730) has the molecular formula C20H21N7O5 and a molecular weight of 439.43 g/mol. Its IUPAC name is N-[(2S)-3-hydroxy-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-2H-benzotriazole-5-carboxamide.
| Compound Name | N-[(2S)-3-hydroxy-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 6723730 |
| Molecular Formula | C20H21N7O5 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | N-[(2S)-3-hydroxy-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-2H-benzotriazole-5-carboxamide |
| SMILES | O=C(N[C@@H](CO)C(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1)c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C20H21N7O5/c28-12-18(21-19(29)13-1-6-16-17(11-13)23-24-22-16)20(30)26-9-7-25(8-10-26)14-2-4-15(5-3-14)27(31)32/h1-6,11,18,28H,7-10,12H2,(H,21,29)(H,22,23,24)/t18-/m0/s1 |
| InChIKey | ZWENAABBJDIRGV-SFHVURJKSA-N |
| XLogP | 0.31 |
| TPSA | 157.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|