C25H25ClN4O8 — CID 3699668
2-(3-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[3-hydroxy-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]acetamide (PubChem CID 3699668) has the molecular formula C25H25ClN4O8 and a molecular weight of 544.95 g/mol. Its IUPAC name is 2-(3-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[3-hydroxy-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]acetamide.
| Compound Name | 2-(3-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[3-hydroxy-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]acetamide |
|---|---|
| PubChem CID | 3699668 |
| Molecular Formula | C25H25ClN4O8 |
| Molecular Weight | 544.95 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 2-(3-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[3-hydroxy-1-[4-(4-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]acetamide |
| SMILES | Cc1c(Cl)c(=O)oc2cc(OCC(=O)NC(CO)C(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)ccc12 |
| InChI | InChI=1S/C25H25ClN4O8/c1-15-19-7-6-18(12-21(19)38-25(34)23(15)26)37-14-22(32)27-20(13-31)24(33)29-10-8-28(9-11-29)16-2-4-17(5-3-16)30(35)36/h2-7,12,20,31H,8-11,13-14H2,1H3,(H,27,32) |
| InChIKey | XTOIMZOSZIJSDL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 155.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.95 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|