C26H24ClN3O6 — CID 4227978
2-(3-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[3-hydroxy-1-oxo-1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-2-yl]acetamide (PubChem CID 4227978) has the molecular formula C26H24ClN3O6 and a molecular weight of 509.95 g/mol. Its IUPAC name is 2-(3-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[3-hydroxy-1-oxo-1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-2-yl]acetamide.
| Compound Name | 2-(3-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[3-hydroxy-1-oxo-1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 4227978 |
| Molecular Formula | C26H24ClN3O6 |
| Molecular Weight | 509.95 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | 2-(3-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[3-hydroxy-1-oxo-1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-2-yl]acetamide |
| SMILES | Cc1c(Cl)c(=O)oc2cc(OCC(=O)NC(CO)C(=O)N3CCc4c([nH]c5ccccc45)C3)ccc12 |
| InChI | InChI=1S/C26H24ClN3O6/c1-14-16-7-6-15(10-22(16)36-26(34)24(14)27)35-13-23(32)29-21(12-31)25(33)30-9-8-18-17-4-2-3-5-19(17)28-20(18)11-30/h2-7,10,21,28,31H,8-9,11-13H2,1H3,(H,29,32) |
| InChIKey | HZNWDVICUXFRBP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.95 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|