C23H23ClN2O6 — CID 6724288
(2S)-N-benzyl-2-[[2-(3-chloro-4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-3-hydroxy-N-methylpropanamide (PubChem CID 6724288) has the molecular formula C23H23ClN2O6 and a molecular weight of 458.90 g/mol. Its IUPAC name is (2S)-N-benzyl-2-[[2-(3-chloro-4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-3-hydroxy-N-methylpropanamide.
| Compound Name | (2S)-N-benzyl-2-[[2-(3-chloro-4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-3-hydroxy-N-methylpropanamide |
|---|---|
| PubChem CID | 6724288 |
| Molecular Formula | C23H23ClN2O6 |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | (2S)-N-benzyl-2-[[2-(3-chloro-4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-3-hydroxy-N-methylpropanamide |
| SMILES | Cc1c(Cl)c(=O)oc2cc(OCC(=O)N[C@@H](CO)C(=O)N(C)Cc3ccccc3)ccc12 |
| InChI | InChI=1S/C23H23ClN2O6/c1-14-17-9-8-16(10-19(17)32-23(30)21(14)24)31-13-20(28)25-18(12-27)22(29)26(2)11-15-6-4-3-5-7-15/h3-10,18,27H,11-13H2,1-2H3,(H,25,28)/t18-/m0/s1 |
| InChIKey | PVFBKFAFPZUUQS-SFHVURJKSA-N |
| XLogP | 2.27 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|