C22H25ClN2O6 — CID 4133859
N-(2-bicyclo[2.2.1]heptanyl)-2-[[2-(3-chloro-4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-3-hydroxypropanamide (PubChem CID 4133859) has the molecular formula C22H25ClN2O6 and a molecular weight of 448.90 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanyl)-2-[[2-(3-chloro-4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-3-hydroxypropanamide.
| Compound Name | N-(2-bicyclo[2.2.1]heptanyl)-2-[[2-(3-chloro-4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 4133859 |
| Molecular Formula | C22H25ClN2O6 |
| Molecular Weight | 448.90 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanyl)-2-[[2-(3-chloro-4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-3-hydroxypropanamide |
| SMILES | Cc1c(Cl)c(=O)oc2cc(OCC(=O)NC(CO)C(=O)NC3CC4CCC3C4)ccc12 |
| InChI | InChI=1S/C22H25ClN2O6/c1-11-15-5-4-14(8-18(15)31-22(29)20(11)23)30-10-19(27)24-17(9-26)21(28)25-16-7-12-2-3-13(16)6-12/h4-5,8,12-13,16-17,26H,2-3,6-7,9-10H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | VDMGEGKMRSMHAU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.90 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|