C21H22F3NO4 — CID 98751984
N-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyacetamide (PubChem CID 98751984) has the molecular formula C21H22F3NO4 and a molecular weight of 409.40 g/mol. Its IUPAC name is N-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyacetamide.
| Compound Name | N-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyacetamide |
|---|---|
| PubChem CID | 98751984 |
| Molecular Formula | C21H22F3NO4 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyacetamide |
| SMILES | C[C@@H](NC(=O)COc1ccc2c(C(F)(F)F)cc(=O)oc2c1)[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C21H22F3NO4/c1-11(16-7-12-2-3-13(16)6-12)25-19(26)10-28-14-4-5-15-17(21(22,23)24)9-20(27)29-18(15)8-14/h4-5,8-9,11-13,16H,2-3,6-7,10H2,1H3,(H,25,26)/t11-,12+,13+,16-/m1/s1 |
| InChIKey | SVRGOKOGMIAILY-LMOYCYGVSA-N |
| XLogP | 4.13 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|