C20H24F3NO4 — CID 55321270
N,N-bis(2-methylpropyl)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyacetamide (PubChem CID 55321270) has the molecular formula C20H24F3NO4 and a molecular weight of 399.41 g/mol. Its IUPAC name is N,N-bis(2-methylpropyl)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyacetamide.
| Compound Name | N,N-bis(2-methylpropyl)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyacetamide |
|---|---|
| PubChem CID | 55321270 |
| Molecular Formula | C20H24F3NO4 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | N,N-bis(2-methylpropyl)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyacetamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)COc1ccc2c(C(F)(F)F)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H24F3NO4/c1-12(2)9-24(10-13(3)4)18(25)11-27-14-5-6-15-16(20(21,22)23)8-19(26)28-17(15)7-14/h5-8,12-13H,9-11H2,1-4H3 |
| InChIKey | VEAZDFACJXRBKX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|