C20H16F3NO4 — CID 29405387
N-(2,6-dimethylphenyl)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyacetamide (PubChem CID 29405387) has the molecular formula C20H16F3NO4 and a molecular weight of 391.35 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyacetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyacetamide |
|---|---|
| PubChem CID | 29405387 |
| Molecular Formula | C20H16F3NO4 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyacetamide |
| SMILES | Cc1cccc(C)c1NC(=O)COc1ccc2c(C(F)(F)F)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H16F3NO4/c1-11-4-3-5-12(2)19(11)24-17(25)10-27-13-6-7-14-15(20(21,22)23)9-18(26)28-16(14)8-13/h3-9H,10H2,1-2H3,(H,24,25) |
| InChIKey | SODKGKWDWIYQAL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|