C21H18F3NO5 — CID 24581655
2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxy-N-(2-propoxyphenyl)acetamide (PubChem CID 24581655) has the molecular formula C21H18F3NO5 and a molecular weight of 421.37 g/mol. Its IUPAC name is 2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxy-N-(2-propoxyphenyl)acetamide.
| Compound Name | 2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxy-N-(2-propoxyphenyl)acetamide |
|---|---|
| PubChem CID | 24581655 |
| Molecular Formula | C21H18F3NO5 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxy-N-(2-propoxyphenyl)acetamide |
| SMILES | CCCOc1ccccc1NC(=O)COc1ccc2c(C(F)(F)F)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H18F3NO5/c1-2-9-28-17-6-4-3-5-16(17)25-19(26)12-29-13-7-8-14-15(21(22,23)24)11-20(27)30-18(14)10-13/h3-8,10-11H,2,9,12H2,1H3,(H,25,26) |
| InChIKey | PSMXQIVRBHXRBC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|