C27H25NO5 — CID 24581989
2-(2-methyl-4-oxo-3-phenylchromen-7-yl)oxy-N-(2-propoxyphenyl)acetamide (PubChem CID 24581989) has the molecular formula C27H25NO5 and a molecular weight of 443.50 g/mol. Its IUPAC name is 2-(2-methyl-4-oxo-3-phenylchromen-7-yl)oxy-N-(2-propoxyphenyl)acetamide.
| Compound Name | 2-(2-methyl-4-oxo-3-phenylchromen-7-yl)oxy-N-(2-propoxyphenyl)acetamide |
|---|---|
| PubChem CID | 24581989 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 2-(2-methyl-4-oxo-3-phenylchromen-7-yl)oxy-N-(2-propoxyphenyl)acetamide |
| SMILES | CCCOc1ccccc1NC(=O)COc1ccc2c(=O)c(-c3ccccc3)c(C)oc2c1 |
| InChI | InChI=1S/C27H25NO5/c1-3-15-31-23-12-8-7-11-22(23)28-25(29)17-32-20-13-14-21-24(16-20)33-18(2)26(27(21)30)19-9-5-4-6-10-19/h4-14,16H,3,15,17H2,1-2H3,(H,28,29) |
| InChIKey | YCCMPUPNGAKDKI-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |