C24H17F2NO5 — CID 2405473
2-[3-(4-fluorophenoxy)-2-methyl-4-oxochromen-7-yl]oxy-N-(2-fluorophenyl)acetamide (PubChem CID 2405473) has the molecular formula C24H17F2NO5 and a molecular weight of 437.40 g/mol. Its IUPAC name is 2-[3-(4-fluorophenoxy)-2-methyl-4-oxochromen-7-yl]oxy-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[3-(4-fluorophenoxy)-2-methyl-4-oxochromen-7-yl]oxy-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 2405473 |
| Molecular Formula | C24H17F2NO5 |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 2-[3-(4-fluorophenoxy)-2-methyl-4-oxochromen-7-yl]oxy-N-(2-fluorophenyl)acetamide |
| SMILES | Cc1oc2cc(OCC(=O)Nc3ccccc3F)ccc2c(=O)c1Oc1ccc(F)cc1 |
| InChI | InChI=1S/C24H17F2NO5/c1-14-24(32-16-8-6-15(25)7-9-16)23(29)18-11-10-17(12-21(18)31-14)30-13-22(28)27-20-5-3-2-4-19(20)26/h2-12H,13H2,1H3,(H,27,28) |
| InChIKey | VVZIJURSJOQMML-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |