C18H12FO5- — CID 6955021
2-[3-(4-fluorophenyl)-2-methyl-4-oxochromen-7-yl]oxyacetate (PubChem CID 6955021) has the molecular formula C18H12FO5- and a molecular weight of 327.29 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)-2-methyl-4-oxochromen-7-yl]oxyacetate.
| Compound Name | 2-[3-(4-fluorophenyl)-2-methyl-4-oxochromen-7-yl]oxyacetate |
|---|---|
| PubChem CID | 6955021 |
| Molecular Formula | C18H12FO5- |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2-[3-(4-fluorophenyl)-2-methyl-4-oxochromen-7-yl]oxyacetate |
| SMILES | Cc1oc2cc(OCC(=O)[O-])ccc2c(=O)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H13FO5/c1-10-17(11-2-4-12(19)5-3-11)18(22)14-7-6-13(8-15(14)24-10)23-9-16(20)21/h2-8H,9H2,1H3,(H,20,21)/p-1 |
| InChIKey | DNYWQKFRDCKTOD-UHFFFAOYSA-M |
| XLogP | 2.04 |
| TPSA | 79.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |