C21H21ClFNO4 — CID 16957497
[3-(4-fluorophenyl)-2-methyl-4-oxochromen-7-yl] 2-amino-3-methylbutanoate;hydrochloride (PubChem CID 16957497) has the molecular formula C21H21ClFNO4 and a molecular weight of 405.85 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-2-methyl-4-oxochromen-7-yl] 2-amino-3-methylbutanoate;hydrochloride.
| Compound Name | [3-(4-fluorophenyl)-2-methyl-4-oxochromen-7-yl] 2-amino-3-methylbutanoate;hydrochloride |
|---|---|
| PubChem CID | 16957497 |
| Molecular Formula | C21H21ClFNO4 |
| Molecular Weight | 405.85 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | [3-(4-fluorophenyl)-2-methyl-4-oxochromen-7-yl] 2-amino-3-methylbutanoate;hydrochloride |
| SMILES | Cc1oc2cc(OC(=O)C(N)C(C)C)ccc2c(=O)c1-c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C21H20FNO4.ClH/c1-11(2)19(23)21(25)27-15-8-9-16-17(10-15)26-12(3)18(20(16)24)13-4-6-14(22)7-5-13;/h4-11,19H,23H2,1-3H3;1H |
| InChIKey | AHEKFZMNMQFWST-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.85 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|