C25H15F5O5 — CID 110274110
(2-methyl-4-oxo-3-phenylchromen-7-yl) 2-(2,3,4,5,6-pentafluorophenoxy)propanoate (PubChem CID 110274110) has the molecular formula C25H15F5O5 and a molecular weight of 490.38 g/mol. Its IUPAC name is (2-methyl-4-oxo-3-phenylchromen-7-yl) 2-(2,3,4,5,6-pentafluorophenoxy)propanoate.
| Compound Name | (2-methyl-4-oxo-3-phenylchromen-7-yl) 2-(2,3,4,5,6-pentafluorophenoxy)propanoate |
|---|---|
| PubChem CID | 110274110 |
| Molecular Formula | C25H15F5O5 |
| Molecular Weight | 490.38 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | (2-methyl-4-oxo-3-phenylchromen-7-yl) 2-(2,3,4,5,6-pentafluorophenoxy)propanoate |
| SMILES | Cc1oc2cc(OC(=O)C(C)Oc3c(F)c(F)c(F)c(F)c3F)ccc2c(=O)c1-c1ccccc1 |
| InChI | InChI=1S/C25H15F5O5/c1-11-17(13-6-4-3-5-7-13)23(31)15-9-8-14(10-16(15)33-11)35-25(32)12(2)34-24-21(29)19(27)18(26)20(28)22(24)30/h3-10,12H,1-2H3 |
| InChIKey | MTGNESAZBKUBJM-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.38 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|