C22H23ClFNO4 — CID 44659877
[(2R)-1-[3-(3-fluorophenyl)-2-methyl-4-oxochromen-7-yl]oxy-3-methyl-1-oxopentan-2-yl]azanium chloride (PubChem CID 44659877) has the molecular formula C22H23ClFNO4 and a molecular weight of 419.88 g/mol. Its IUPAC name is [(2R)-1-[3-(3-fluorophenyl)-2-methyl-4-oxochromen-7-yl]oxy-3-methyl-1-oxopentan-2-yl]azanium chloride.
| Compound Name | [(2R)-1-[3-(3-fluorophenyl)-2-methyl-4-oxochromen-7-yl]oxy-3-methyl-1-oxopentan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 44659877 |
| Molecular Formula | C22H23ClFNO4 |
| Molecular Weight | 419.88 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | [(2R)-1-[3-(3-fluorophenyl)-2-methyl-4-oxochromen-7-yl]oxy-3-methyl-1-oxopentan-2-yl]azanium chloride |
| SMILES | CCC(C)[C@@H]([NH3+])C(=O)Oc1ccc2c(=O)c(-c3cccc(F)c3)c(C)oc2c1.[Cl-] |
| InChI | InChI=1S/C22H22FNO4.ClH/c1-4-12(2)20(24)22(26)28-16-8-9-17-18(11-16)27-13(3)19(21(17)25)14-6-5-7-15(23)10-14;/h5-12,20H,4,24H2,1-3H3;1H/t12?,20-;/m1./s1 |
| InChIKey | DEHQXVDUGMBZMH-QTCYJRLRSA-N |
| XLogP | 0.47 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.88 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|