C27H30N2O8 — CID 40786441
[2-methyl-3-(4-nitrophenyl)-4-oxochromen-7-yl] (2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 40786441) has the molecular formula C27H30N2O8 and a molecular weight of 510.54 g/mol. Its IUPAC name is [2-methyl-3-(4-nitrophenyl)-4-oxochromen-7-yl] (2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | [2-methyl-3-(4-nitrophenyl)-4-oxochromen-7-yl] (2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 40786441 |
| Molecular Formula | C27H30N2O8 |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | [2-methyl-3-(4-nitrophenyl)-4-oxochromen-7-yl] (2S,3S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CC[C@H](C)[C@H](NC(=O)OC(C)(C)C)C(=O)Oc1ccc2c(=O)c(-c3ccc([N+](=O)[O-])cc3)c(C)oc2c1 |
| InChI | InChI=1S/C27H30N2O8/c1-7-15(2)23(28-26(32)37-27(4,5)6)25(31)36-19-12-13-20-21(14-19)35-16(3)22(24(20)30)17-8-10-18(11-9-17)29(33)34/h8-15,23H,7H2,1-6H3,(H,28,32)/t15-,23-/m0/s1 |
| InChIKey | UNJSUMXTMBCDEV-WNSKOXEYSA-N |
| XLogP | 5.52 |
| TPSA | 137.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|