C23H12ClF3O4 — CID 16546836
[3-(2-chloro-6-fluorophenyl)-2-methyl-4-oxochromen-7-yl] 2,6-difluorobenzoate (PubChem CID 16546836) has the molecular formula C23H12ClF3O4 and a molecular weight of 444.79 g/mol. Its IUPAC name is [3-(2-chloro-6-fluorophenyl)-2-methyl-4-oxochromen-7-yl] 2,6-difluorobenzoate.
| Compound Name | [3-(2-chloro-6-fluorophenyl)-2-methyl-4-oxochromen-7-yl] 2,6-difluorobenzoate |
|---|---|
| PubChem CID | 16546836 |
| Molecular Formula | C23H12ClF3O4 |
| Molecular Weight | 444.79 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | [3-(2-chloro-6-fluorophenyl)-2-methyl-4-oxochromen-7-yl] 2,6-difluorobenzoate |
| SMILES | Cc1oc2cc(OC(=O)c3c(F)cccc3F)ccc2c(=O)c1-c1c(F)cccc1Cl |
| InChI | InChI=1S/C23H12ClF3O4/c1-11-19(20-14(24)4-2-5-15(20)25)22(28)13-9-8-12(10-18(13)30-11)31-23(29)21-16(26)6-3-7-17(21)27/h2-10H,1H3 |
| InChIKey | MWDYUOAOXBUUBU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.79 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|