C26H21NO6 — CID 26216445
methyl 4-[[2-(2-methyl-4-oxo-3-phenylchromen-7-yl)oxyacetyl]amino]benzoate (PubChem CID 26216445) has the molecular formula C26H21NO6 and a molecular weight of 443.46 g/mol. Its IUPAC name is methyl 4-[[2-(2-methyl-4-oxo-3-phenylchromen-7-yl)oxyacetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-(2-methyl-4-oxo-3-phenylchromen-7-yl)oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 26216445 |
| Molecular Formula | C26H21NO6 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | methyl 4-[[2-(2-methyl-4-oxo-3-phenylchromen-7-yl)oxyacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)COc2ccc3c(=O)c(-c4ccccc4)c(C)oc3c2)cc1 |
| InChI | InChI=1S/C26H21NO6/c1-16-24(17-6-4-3-5-7-17)25(29)21-13-12-20(14-22(21)33-16)32-15-23(28)27-19-10-8-18(9-11-19)26(30)31-2/h3-14H,15H2,1-2H3,(H,27,28) |
| InChIKey | PMGXMVBAQCJEMN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |