C22H20F3NO4 — CID 29405432
N-(2,6-diethylphenyl)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyacetamide (PubChem CID 29405432) has the molecular formula C22H20F3NO4 and a molecular weight of 419.40 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyacetamide.
| Compound Name | N-(2,6-diethylphenyl)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyacetamide |
|---|---|
| PubChem CID | 29405432 |
| Molecular Formula | C22H20F3NO4 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyacetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)COc1ccc2c(C(F)(F)F)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H20F3NO4/c1-3-13-6-5-7-14(4-2)21(13)26-19(27)12-29-15-8-9-16-17(22(23,24)25)11-20(28)30-18(16)10-15/h5-11H,3-4,12H2,1-2H3,(H,26,27) |
| InChIKey | OLRCPULWENMHJO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|