C13H11F3N2O4 — CID 2492080
(2S)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxypropanehydrazide (PubChem CID 2492080) has the molecular formula C13H11F3N2O4 and a molecular weight of 316.24 g/mol. Its IUPAC name is (2S)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxypropanehydrazide.
| Compound Name | (2S)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxypropanehydrazide |
|---|---|
| PubChem CID | 2492080 |
| Molecular Formula | C13H11F3N2O4 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | (2S)-2-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxypropanehydrazide |
| SMILES | C[C@H](Oc1ccc2c(C(F)(F)F)cc(=O)oc2c1)C(=O)NN |
| InChI | InChI=1S/C13H11F3N2O4/c1-6(12(20)18-17)21-7-2-3-8-9(13(14,15)16)5-11(19)22-10(8)4-7/h2-6H,17H2,1H3,(H,18,20)/t6-/m0/s1 |
| InChIKey | OGSKPTIRPJAMMI-LURJTMIESA-N |
| XLogP | 1.57 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|