C14H14N2O5 — CID 2108923
(2S)-N-carbamoyl-2-(4-methyl-2-oxochromen-7-yl)oxypropanamide (PubChem CID 2108923) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is (2S)-N-carbamoyl-2-(4-methyl-2-oxochromen-7-yl)oxypropanamide.
| Compound Name | (2S)-N-carbamoyl-2-(4-methyl-2-oxochromen-7-yl)oxypropanamide |
|---|---|
| PubChem CID | 2108923 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (2S)-N-carbamoyl-2-(4-methyl-2-oxochromen-7-yl)oxypropanamide |
| SMILES | Cc1cc(=O)oc2cc(O[C@@H](C)C(=O)NC(N)=O)ccc12 |
| InChI | InChI=1S/C14H14N2O5/c1-7-5-12(17)21-11-6-9(3-4-10(7)11)20-8(2)13(18)16-14(15)19/h3-6,8H,1-2H3,(H3,15,16,18,19)/t8-/m0/s1 |
| InChIKey | ZPNWLTIUIBBZTJ-QMMMGPOBSA-N |
| XLogP | 1.06 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|