C20H18N2O5 — CID 7967896
4-[[(2R)-2-(4-methyl-2-oxochromen-7-yl)oxypropanoyl]amino]benzamide (PubChem CID 7967896) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is 4-[[(2R)-2-(4-methyl-2-oxochromen-7-yl)oxypropanoyl]amino]benzamide.
| Compound Name | 4-[[(2R)-2-(4-methyl-2-oxochromen-7-yl)oxypropanoyl]amino]benzamide |
|---|---|
| PubChem CID | 7967896 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 4-[[(2R)-2-(4-methyl-2-oxochromen-7-yl)oxypropanoyl]amino]benzamide |
| SMILES | Cc1cc(=O)oc2cc(O[C@H](C)C(=O)Nc3ccc(C(N)=O)cc3)ccc12 |
| InChI | InChI=1S/C20H18N2O5/c1-11-9-18(23)27-17-10-15(7-8-16(11)17)26-12(2)20(25)22-14-5-3-13(4-6-14)19(21)24/h3-10,12H,1-2H3,(H2,21,24)(H,22,25)/t12-/m1/s1 |
| InChIKey | CTRNDPRCFQGNQE-GFCCVEGCSA-N |
| XLogP | 2.61 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|