C19H16N2O6 — CID 94332276
(2S)-N-(4-methyl-2-oxochromen-7-yl)-2-(4-nitrophenoxy)propanamide (PubChem CID 94332276) has the molecular formula C19H16N2O6 and a molecular weight of 368.35 g/mol. Its IUPAC name is (2S)-N-(4-methyl-2-oxochromen-7-yl)-2-(4-nitrophenoxy)propanamide.
| Compound Name | (2S)-N-(4-methyl-2-oxochromen-7-yl)-2-(4-nitrophenoxy)propanamide |
|---|---|
| PubChem CID | 94332276 |
| Molecular Formula | C19H16N2O6 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (2S)-N-(4-methyl-2-oxochromen-7-yl)-2-(4-nitrophenoxy)propanamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)[C@H](C)Oc3ccc([N+](=O)[O-])cc3)ccc12 |
| InChI | InChI=1S/C19H16N2O6/c1-11-9-18(22)27-17-10-13(3-8-16(11)17)20-19(23)12(2)26-15-6-4-14(5-7-15)21(24)25/h3-10,12H,1-2H3,(H,20,23)/t12-/m0/s1 |
| InChIKey | FAENHSBNMDQUOY-LBPRGKRZSA-N |
| XLogP | 3.42 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|