C20H15N3O6S — CID 19191782
2-(4-methyl-2-oxochromen-7-yl)oxy-N-(6-nitro-1,3-benzothiazol-2-yl)propanamide (PubChem CID 19191782) has the molecular formula C20H15N3O6S and a molecular weight of 425.42 g/mol. Its IUPAC name is 2-(4-methyl-2-oxochromen-7-yl)oxy-N-(6-nitro-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | 2-(4-methyl-2-oxochromen-7-yl)oxy-N-(6-nitro-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 19191782 |
| Molecular Formula | C20H15N3O6S |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 2-(4-methyl-2-oxochromen-7-yl)oxy-N-(6-nitro-1,3-benzothiazol-2-yl)propanamide |
| SMILES | Cc1cc(=O)oc2cc(OC(C)C(=O)Nc3nc4ccc([N+](=O)[O-])cc4s3)ccc12 |
| InChI | InChI=1S/C20H15N3O6S/c1-10-7-18(24)29-16-9-13(4-5-14(10)16)28-11(2)19(25)22-20-21-15-6-3-12(23(26)27)8-17(15)30-20/h3-9,11H,1-2H3,(H,21,22,25) |
| InChIKey | HIKQHTMYZWICGS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|