C19H13FN2O4S — CID 2430791
N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide (PubChem CID 2430791) has the molecular formula C19H13FN2O4S and a molecular weight of 384.39 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 2430791 |
| Molecular Formula | C19H13FN2O4S |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)Nc3nc4ccc(F)cc4s3)ccc12 |
| InChI | InChI=1S/C19H13FN2O4S/c1-10-6-18(24)26-15-8-12(3-4-13(10)15)25-9-17(23)22-19-21-14-5-2-11(20)7-16(14)27-19/h2-8H,9H2,1H3,(H,21,22,23) |
| InChIKey | DFWVGTATMOERAY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|