C22H18N2O5 — CID 71826068
N-(7-methoxyquinolin-3-yl)-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide (PubChem CID 71826068) has the molecular formula C22H18N2O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is N-(7-methoxyquinolin-3-yl)-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-(7-methoxyquinolin-3-yl)-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 71826068 |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-(7-methoxyquinolin-3-yl)-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide |
| SMILES | COc1ccc2cc(NC(=O)COc3ccc4c(C)cc(=O)oc4c3)cnc2c1 |
| InChI | InChI=1S/C22H18N2O5/c1-13-7-22(26)29-20-10-17(5-6-18(13)20)28-12-21(25)24-15-8-14-3-4-16(27-2)9-19(14)23-11-15/h3-11H,12H2,1-2H3,(H,24,25) |
| InChIKey | GLHUUUYWKRXCHJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|