C22H15FN2O3S — CID 2550667
2-(4-benzoylphenoxy)-N-(6-fluoro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 2550667) has the molecular formula C22H15FN2O3S and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-(4-benzoylphenoxy)-N-(6-fluoro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(4-benzoylphenoxy)-N-(6-fluoro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 2550667 |
| Molecular Formula | C22H15FN2O3S |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 2-(4-benzoylphenoxy)-N-(6-fluoro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | O=C(COc1ccc(C(=O)c2ccccc2)cc1)Nc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C22H15FN2O3S/c23-16-8-11-18-19(12-16)29-22(24-18)25-20(26)13-28-17-9-6-15(7-10-17)21(27)14-4-2-1-3-5-14/h1-12H,13H2,(H,24,25,26) |
| InChIKey | LJASELDKDJLZBO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |