C21H15N3O8S — CID 23825717
[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-(4-methyl-2-oxochromen-7-yl)oxyacetate (PubChem CID 23825717) has the molecular formula C21H15N3O8S and a molecular weight of 469.43 g/mol. Its IUPAC name is [2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-(4-methyl-2-oxochromen-7-yl)oxyacetate.
| Compound Name | [2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-(4-methyl-2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 23825717 |
| Molecular Formula | C21H15N3O8S |
| Molecular Weight | 469.43 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | [2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-(4-methyl-2-oxochromen-7-yl)oxyacetate |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)OCC(=O)Nc3nc4ccc([N+](=O)[O-])cc4s3)ccc12 |
| InChI | InChI=1S/C21H15N3O8S/c1-11-6-19(26)32-16-8-13(3-4-14(11)16)30-10-20(27)31-9-18(25)23-21-22-15-5-2-12(24(28)29)7-17(15)33-21/h2-8H,9-10H2,1H3,(H,22,23,25) |
| InChIKey | DCEWMURPSJQFMW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 150.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|