C18H16ClN3O4S — CID 2968089
2-(4-chloro-3,5-dimethylphenoxy)-N-(6-nitro-1,3-benzothiazol-2-yl)propanamide (PubChem CID 2968089) has the molecular formula C18H16ClN3O4S and a molecular weight of 405.86 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylphenoxy)-N-(6-nitro-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-(6-nitro-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 2968089 |
| Molecular Formula | C18H16ClN3O4S |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-(6-nitro-1,3-benzothiazol-2-yl)propanamide |
| SMILES | Cc1cc(OC(C)C(=O)Nc2nc3ccc([N+](=O)[O-])cc3s2)cc(C)c1Cl |
| InChI | InChI=1S/C18H16ClN3O4S/c1-9-6-13(7-10(2)16(9)19)26-11(3)17(23)21-18-20-14-5-4-12(22(24)25)8-15(14)27-18/h4-8,11H,1-3H3,(H,20,21,23) |
| InChIKey | LLYNUQFLGROQCV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|