C22H22N2O5 — CID 42941413
N-[(2,4-dimethylphenyl)carbamoyl]-2-(4-methyl-2-oxochromen-7-yl)oxypropanamide (PubChem CID 42941413) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)carbamoyl]-2-(4-methyl-2-oxochromen-7-yl)oxypropanamide.
| Compound Name | N-[(2,4-dimethylphenyl)carbamoyl]-2-(4-methyl-2-oxochromen-7-yl)oxypropanamide |
|---|---|
| PubChem CID | 42941413 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-[(2,4-dimethylphenyl)carbamoyl]-2-(4-methyl-2-oxochromen-7-yl)oxypropanamide |
| SMILES | Cc1ccc(NC(=O)NC(=O)C(C)Oc2ccc3c(C)cc(=O)oc3c2)c(C)c1 |
| InChI | InChI=1S/C22H22N2O5/c1-12-5-8-18(14(3)9-12)23-22(27)24-21(26)15(4)28-16-6-7-17-13(2)10-20(25)29-19(17)11-16/h5-11,15H,1-4H3,(H2,23,24,26,27) |
| InChIKey | VIZREKQWYZGPIX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|