C18H21NO6 — CID 928635
(2R)-3-methyl-2-[[(2S)-2-(4-methyl-2-oxochromen-7-yl)oxypropanoyl]amino]butanoic acid (PubChem CID 928635) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is (2R)-3-methyl-2-[[(2S)-2-(4-methyl-2-oxochromen-7-yl)oxypropanoyl]amino]butanoic acid.
| Compound Name | (2R)-3-methyl-2-[[(2S)-2-(4-methyl-2-oxochromen-7-yl)oxypropanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 928635 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | (2R)-3-methyl-2-[[(2S)-2-(4-methyl-2-oxochromen-7-yl)oxypropanoyl]amino]butanoic acid |
| SMILES | Cc1cc(=O)oc2cc(O[C@@H](C)C(=O)N[C@@H](C(=O)O)C(C)C)ccc12 |
| InChI | InChI=1S/C18H21NO6/c1-9(2)16(18(22)23)19-17(21)11(4)24-12-5-6-13-10(3)7-15(20)25-14(13)8-12/h5-9,11,16H,1-4H3,(H,19,21)(H,22,23)/t11-,16+/m0/s1 |
| InChIKey | SGONTALMSQZNQG-MEDUHNTESA-N |
| XLogP | 2.09 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|