C21H20FNO4 — CID 7967924
(2R)-N-[(1S)-1-(4-fluorophenyl)ethyl]-2-(4-methyl-2-oxochromen-7-yl)oxypropanamide (PubChem CID 7967924) has the molecular formula C21H20FNO4 and a molecular weight of 369.39 g/mol. Its IUPAC name is (2R)-N-[(1S)-1-(4-fluorophenyl)ethyl]-2-(4-methyl-2-oxochromen-7-yl)oxypropanamide.
| Compound Name | (2R)-N-[(1S)-1-(4-fluorophenyl)ethyl]-2-(4-methyl-2-oxochromen-7-yl)oxypropanamide |
|---|---|
| PubChem CID | 7967924 |
| Molecular Formula | C21H20FNO4 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | (2R)-N-[(1S)-1-(4-fluorophenyl)ethyl]-2-(4-methyl-2-oxochromen-7-yl)oxypropanamide |
| SMILES | Cc1cc(=O)oc2cc(O[C@H](C)C(=O)N[C@@H](C)c3ccc(F)cc3)ccc12 |
| InChI | InChI=1S/C21H20FNO4/c1-12-10-20(24)27-19-11-17(8-9-18(12)19)26-14(3)21(25)23-13(2)15-4-6-16(22)7-5-15/h4-11,13-14H,1-3H3,(H,23,25)/t13-,14+/m0/s1 |
| InChIKey | VBWNVTBXRAGOCK-UONOGXRCSA-N |
| XLogP | 3.89 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|