C19H14F2O4 — CID 7967871
7-[(2R)-1-(3,4-difluorophenyl)-1-oxopropan-2-yl]oxy-4-methylchromen-2-one (PubChem CID 7967871) has the molecular formula C19H14F2O4 and a molecular weight of 344.31 g/mol. Its IUPAC name is 7-[(2R)-1-(3,4-difluorophenyl)-1-oxopropan-2-yl]oxy-4-methylchromen-2-one.
| Compound Name | 7-[(2R)-1-(3,4-difluorophenyl)-1-oxopropan-2-yl]oxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 7967871 |
| Molecular Formula | C19H14F2O4 |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 7-[(2R)-1-(3,4-difluorophenyl)-1-oxopropan-2-yl]oxy-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(O[C@H](C)C(=O)c3ccc(F)c(F)c3)ccc12 |
| InChI | InChI=1S/C19H14F2O4/c1-10-7-18(22)25-17-9-13(4-5-14(10)17)24-11(2)19(23)12-3-6-15(20)16(21)8-12/h3-9,11H,1-2H3/t11-/m1/s1 |
| InChIKey | GBJKTZFPHQKGDX-LLVKDONJSA-N |
| XLogP | 4.03 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|