C26H24N2O6 — CID 4210347
methyl 2-[2-(3,4-dimethyl-2-oxochromen-7-yl)oxyacetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 4210347) has the molecular formula C26H24N2O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is methyl 2-[2-(3,4-dimethyl-2-oxochromen-7-yl)oxyacetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 2-[2-(3,4-dimethyl-2-oxochromen-7-yl)oxyacetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 4210347 |
| Molecular Formula | C26H24N2O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | methyl 2-[2-(3,4-dimethyl-2-oxochromen-7-yl)oxyacetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)C1Cc2c([nH]c3ccccc23)CN1C(=O)COc1ccc2c(C)c(C)c(=O)oc2c1 |
| InChI | InChI=1S/C26H24N2O6/c1-14-15(2)25(30)34-23-10-16(8-9-17(14)23)33-13-24(29)28-12-21-19(11-22(28)26(31)32-3)18-6-4-5-7-20(18)27-21/h4-10,22,27H,11-13H2,1-3H3 |
| InChIKey | AEQGZBFGJFKTQE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 101.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|