C21H25N5O4S — CID 4834386
methyl 2-[2-[[5-(1-amino-2-methylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 4834386) has the molecular formula C21H25N5O4S and a molecular weight of 443.53 g/mol. Its IUPAC name is methyl 2-[2-[[5-(1-amino-2-methylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 2-[2-[[5-(1-amino-2-methylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 4834386 |
| Molecular Formula | C21H25N5O4S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | methyl 2-[2-[[5-(1-amino-2-methylpropyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)C1Cc2c([nH]c3ccccc23)CN1C(=O)CSc1nnc(C(N)C(C)C)o1 |
| InChI | InChI=1S/C21H25N5O4S/c1-11(2)18(22)19-24-25-21(30-19)31-10-17(27)26-9-15-13(8-16(26)20(28)29-3)12-6-4-5-7-14(12)23-15/h4-7,11,16,18,23H,8-10,22H2,1-3H3 |
| InChIKey | QQGHSASVZMBYOM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 127.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|