C32H27ClN2O6 — CID 3738466
methyl 2-[2-(3-benzyl-6-chloro-4-methyl-2-oxochromen-7-yl)oxyacetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 3738466) has the molecular formula C32H27ClN2O6 and a molecular weight of 571.03 g/mol. Its IUPAC name is methyl 2-[2-(3-benzyl-6-chloro-4-methyl-2-oxochromen-7-yl)oxyacetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 2-[2-(3-benzyl-6-chloro-4-methyl-2-oxochromen-7-yl)oxyacetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 3738466 |
| Molecular Formula | C32H27ClN2O6 |
| Molecular Weight | 571.03 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | methyl 2-[2-(3-benzyl-6-chloro-4-methyl-2-oxochromen-7-yl)oxyacetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)C1Cc2c([nH]c3ccccc23)CN1C(=O)COc1cc2oc(=O)c(Cc3ccccc3)c(C)c2cc1Cl |
| InChI | InChI=1S/C32H27ClN2O6/c1-18-21-13-24(33)29(15-28(21)41-31(37)22(18)12-19-8-4-3-5-9-19)40-17-30(36)35-16-26-23(14-27(35)32(38)39-2)20-10-6-7-11-25(20)34-26/h3-11,13,15,27,34H,12,14,16-17H2,1-2H3 |
| InChIKey | FXRJEWAGVIAVSR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 101.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.03 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|