C26H21ClO5 — CID 42235094
methyl (2S)-2-(3-benzyl-6-chloro-4-methyl-2-oxochromen-7-yl)oxy-2-phenylacetate (PubChem CID 42235094) has the molecular formula C26H21ClO5 and a molecular weight of 448.90 g/mol. Its IUPAC name is methyl (2S)-2-(3-benzyl-6-chloro-4-methyl-2-oxochromen-7-yl)oxy-2-phenylacetate.
| Compound Name | methyl (2S)-2-(3-benzyl-6-chloro-4-methyl-2-oxochromen-7-yl)oxy-2-phenylacetate |
|---|---|
| PubChem CID | 42235094 |
| Molecular Formula | C26H21ClO5 |
| Molecular Weight | 448.90 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | methyl (2S)-2-(3-benzyl-6-chloro-4-methyl-2-oxochromen-7-yl)oxy-2-phenylacetate |
| SMILES | COC(=O)[C@@H](Oc1cc2oc(=O)c(Cc3ccccc3)c(C)c2cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C26H21ClO5/c1-16-19-14-21(27)23(31-24(26(29)30-2)18-11-7-4-8-12-18)15-22(19)32-25(28)20(16)13-17-9-5-3-6-10-17/h3-12,14-15,24H,13H2,1-2H3/t24-/m0/s1 |
| InChIKey | WTRZDAIVJOLJNV-DEOSSOPVSA-N |
| XLogP | 5.64 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.90 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|