C21H19ClO4 — CID 42154879
3-benzyl-6-chloro-4-methyl-7-[(2R)-3-oxobutan-2-yl]oxychromen-2-one (PubChem CID 42154879) has the molecular formula C21H19ClO4 and a molecular weight of 370.83 g/mol. Its IUPAC name is 3-benzyl-6-chloro-4-methyl-7-[(2R)-3-oxobutan-2-yl]oxychromen-2-one.
| Compound Name | 3-benzyl-6-chloro-4-methyl-7-[(2R)-3-oxobutan-2-yl]oxychromen-2-one |
|---|---|
| PubChem CID | 42154879 |
| Molecular Formula | C21H19ClO4 |
| Molecular Weight | 370.83 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 3-benzyl-6-chloro-4-methyl-7-[(2R)-3-oxobutan-2-yl]oxychromen-2-one |
| SMILES | CC(=O)[C@@H](C)Oc1cc2oc(=O)c(Cc3ccccc3)c(C)c2cc1Cl |
| InChI | InChI=1S/C21H19ClO4/c1-12-16-10-18(22)20(25-14(3)13(2)23)11-19(16)26-21(24)17(12)9-15-7-5-4-6-8-15/h4-8,10-11,14H,9H2,1-3H3/t14-/m1/s1 |
| InChIKey | XYHFYOHLYNBENE-CQSZACIVSA-N |
| XLogP | 4.70 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.83 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|