C15H14Cl2O5 — CID 681430
ethyl (2R)-2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxypropanoate (PubChem CID 681430) has the molecular formula C15H14Cl2O5 and a molecular weight of 345.18 g/mol. Its IUPAC name is ethyl (2R)-2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxypropanoate.
| Compound Name | ethyl (2R)-2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxypropanoate |
|---|---|
| PubChem CID | 681430 |
| Molecular Formula | C15H14Cl2O5 |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | ethyl (2R)-2-(3,6-dichloro-4-methyl-2-oxochromen-7-yl)oxypropanoate |
| SMILES | CCOC(=O)[C@@H](C)Oc1cc2oc(=O)c(Cl)c(C)c2cc1Cl |
| InChI | InChI=1S/C15H14Cl2O5/c1-4-20-14(18)8(3)21-12-6-11-9(5-10(12)16)7(2)13(17)15(19)22-11/h5-6,8H,4H2,1-3H3/t8-/m1/s1 |
| InChIKey | FFKVNKTXECJUPS-MRVPVSSYSA-N |
| XLogP | 3.74 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|