C18H20ClNO6S — CID 171911644
6-chloro-7-[1-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxopropan-2-yl]oxy-3,4-dimethylchromen-2-one (PubChem CID 171911644) has the molecular formula C18H20ClNO6S and a molecular weight of 413.88 g/mol. Its IUPAC name is 6-chloro-7-[1-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxopropan-2-yl]oxy-3,4-dimethylchromen-2-one.
| Compound Name | 6-chloro-7-[1-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxopropan-2-yl]oxy-3,4-dimethylchromen-2-one |
|---|---|
| PubChem CID | 171911644 |
| Molecular Formula | C18H20ClNO6S |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 6-chloro-7-[1-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxopropan-2-yl]oxy-3,4-dimethylchromen-2-one |
| SMILES | Cc1c(C)c2cc(Cl)c(OC(C)C(=O)N3CCS(=O)(=O)CC3)cc2oc1=O |
| InChI | InChI=1S/C18H20ClNO6S/c1-10-11(2)18(22)26-15-9-16(14(19)8-13(10)15)25-12(3)17(21)20-4-6-27(23,24)7-5-20/h8-9,12H,4-7H2,1-3H3 |
| InChIKey | ZMNDVPGEPLHGOA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|