C15H12ClO5- — CID 6943031
(2S)-2-[(8-chloro-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanoate (PubChem CID 6943031) has the molecular formula C15H12ClO5- and a molecular weight of 307.71 g/mol. Its IUPAC name is (2S)-2-[(8-chloro-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanoate.
| Compound Name | (2S)-2-[(8-chloro-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanoate |
|---|---|
| PubChem CID | 6943031 |
| Molecular Formula | C15H12ClO5- |
| Molecular Weight | 307.71 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | (2S)-2-[(8-chloro-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanoate |
| SMILES | C[C@H](Oc1cc2oc(=O)c3c(c2cc1Cl)CCC3)C(=O)[O-] |
| InChI | InChI=1S/C15H13ClO5/c1-7(14(17)18)20-13-6-12-10(5-11(13)16)8-3-2-4-9(8)15(19)21-12/h5-7H,2-4H2,1H3,(H,17,18)/p-1/t7-/m0/s1 |
| InChIKey | PRXUHYHOJMGTHT-ZETCQYMHSA-M |
| XLogP | 1.45 |
| TPSA | 79.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.71 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|