C19H18O8-2 — CID 7077000
(2R)-2-[[1-[(1S)-1-carboxylatoethoxy]-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl]oxy]propanoate (PubChem CID 7077000) has the molecular formula C19H18O8-2 and a molecular weight of 374.35 g/mol. Its IUPAC name is (2R)-2-[[1-[(1S)-1-carboxylatoethoxy]-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl]oxy]propanoate.
| Compound Name | (2R)-2-[[1-[(1S)-1-carboxylatoethoxy]-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl]oxy]propanoate |
|---|---|
| PubChem CID | 7077000 |
| Molecular Formula | C19H18O8-2 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | (2R)-2-[[1-[(1S)-1-carboxylatoethoxy]-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl]oxy]propanoate |
| SMILES | C[C@H](Oc1cc(O[C@H](C)C(=O)[O-])cc2oc(=O)c3c(c12)CCCC3)C(=O)[O-] |
| InChI | InChI=1S/C19H20O8/c1-9(17(20)21)25-11-7-14(26-10(2)18(22)23)16-12-5-3-4-6-13(12)19(24)27-15(16)8-11/h7-10H,3-6H2,1-2H3,(H,20,21)(H,22,23)/p-2/t9-,10+/m1/s1 |
| InChIKey | RBCSXPSGEQDPMU-ZJUUUORDSA-L |
| XLogP | -0.29 |
| TPSA | 128.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|