C20H26ClN2O4+ — CID 7600189
3-[[(2S)-2-[(8-chloro-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanoyl]amino]propyl-dimethylazanium (PubChem CID 7600189) has the molecular formula C20H26ClN2O4+ and a molecular weight of 393.89 g/mol. Its IUPAC name is 3-[[(2S)-2-[(8-chloro-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanoyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[(2S)-2-[(8-chloro-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanoyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7600189 |
| Molecular Formula | C20H26ClN2O4+ |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 3-[[(2S)-2-[(8-chloro-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanoyl]amino]propyl-dimethylazanium |
| SMILES | C[C@H](Oc1cc2oc(=O)c3c(c2cc1Cl)CCC3)C(=O)NCCC[NH+](C)C |
| InChI | InChI=1S/C20H25ClN2O4/c1-12(19(24)22-8-5-9-23(2)3)26-18-11-17-15(10-16(18)21)13-6-4-7-14(13)20(25)27-17/h10-12H,4-9H2,1-3H3,(H,22,24)/p+1/t12-/m0/s1 |
| InChIKey | MLIZVZOJQHORGJ-LBPRGKRZSA-O |
| XLogP | 1.35 |
| TPSA | 72.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|