C17H17ClO5 — CID 717399
methyl (2R)-2-[(2-chloro-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxy]propanoate (PubChem CID 717399) has the molecular formula C17H17ClO5 and a molecular weight of 336.77 g/mol. Its IUPAC name is methyl (2R)-2-[(2-chloro-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxy]propanoate.
| Compound Name | methyl (2R)-2-[(2-chloro-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxy]propanoate |
|---|---|
| PubChem CID | 717399 |
| Molecular Formula | C17H17ClO5 |
| Molecular Weight | 336.77 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | methyl (2R)-2-[(2-chloro-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl)oxy]propanoate |
| SMILES | COC(=O)[C@@H](C)Oc1cc2oc(=O)c3c(c2cc1Cl)CCCC3 |
| InChI | InChI=1S/C17H17ClO5/c1-9(16(19)21-2)22-15-8-14-12(7-13(15)18)10-5-3-4-6-11(10)17(20)23-14/h7-9H,3-6H2,1-2H3/t9-/m1/s1 |
| InChIKey | QPYGAUAXLDRDKP-SECBINFHSA-N |
| XLogP | 3.27 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.77 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|